C9H11NO7S — CID 88690638
methyl 3,6-dimethoxy-2-nitrobenzenesulfonate (PubChem CID 88690638) has the molecular formula C9H11NO7S and a molecular weight of 277.25 g/mol. Its IUPAC name is methyl 3,6-dimethoxy-2-nitrobenzenesulfonate.
| Compound Name | methyl 3,6-dimethoxy-2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 88690638 |
| Molecular Formula | C9H11NO7S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | methyl 3,6-dimethoxy-2-nitrobenzenesulfonate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11NO7S/c1-15-6-4-5-7(16-2)9(8(6)10(11)12)18(13,14)17-3/h4-5H,1-3H3 |
| InChIKey | MFWMUEAWVMTVGF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|