C10H13NO5S — CID 139246292
methyl 2,4,6-trimethyl-3-nitrobenzenesulfonate (PubChem CID 139246292) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is methyl 2,4,6-trimethyl-3-nitrobenzenesulfonate.
| Compound Name | methyl 2,4,6-trimethyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 139246292 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | methyl 2,4,6-trimethyl-3-nitrobenzenesulfonate |
| SMILES | COS(=O)(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C10H13NO5S/c1-6-5-7(2)10(17(14,15)16-4)8(3)9(6)11(12)13/h5H,1-4H3 |
| InChIKey | ODVNXTMZXWTWDH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|