C10H10F3NO2 — CID 121234506
1,3,5-trimethyl-2-nitro-4-(trifluoromethyl)benzene (PubChem CID 121234506) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-nitro-4-(trifluoromethyl)benzene.
| Compound Name | 1,3,5-trimethyl-2-nitro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 121234506 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1,3,5-trimethyl-2-nitro-4-(trifluoromethyl)benzene |
| SMILES | Cc1cc(C)c(C(F)(F)F)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10F3NO2/c1-5-4-6(2)9(14(15)16)7(3)8(5)10(11,12)13/h4H,1-3H3 |
| InChIKey | AZQDIQXODCEXHS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|