C11H16O3S — CID 13310201
methyl 2,3,5,6-tetramethylbenzenesulfonate (PubChem CID 13310201) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is methyl 2,3,5,6-tetramethylbenzenesulfonate.
| Compound Name | methyl 2,3,5,6-tetramethylbenzenesulfonate |
|---|---|
| PubChem CID | 13310201 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | methyl 2,3,5,6-tetramethylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C11H16O3S/c1-7-6-8(2)10(4)11(9(7)3)15(12,13)14-5/h6H,1-5H3 |
| InChIKey | BTAPPQHQROKONT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|