C19H27NO6S2 — CID 163939417
amino 2,4,6-trimethylbenzenesulfonate;methyl 2,4,6-trimethylbenzenesulfonate (PubChem CID 163939417) has the molecular formula C19H27NO6S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is amino 2,4,6-trimethylbenzenesulfonate;methyl 2,4,6-trimethylbenzenesulfonate.
| Compound Name | amino 2,4,6-trimethylbenzenesulfonate;methyl 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 163939417 |
| Molecular Formula | C19H27NO6S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | amino 2,4,6-trimethylbenzenesulfonate;methyl 2,4,6-trimethylbenzenesulfonate |
| SMILES | COS(=O)(=O)c1c(C)cc(C)cc1C.Cc1cc(C)c(S(=O)(=O)ON)c(C)c1 |
| InChI | InChI=1S/C10H14O3S.C9H13NO3S/c1-7-5-8(2)10(9(3)6-7)14(11,12)13-4;1-6-4-7(2)9(8(3)5-6)14(11,12)13-10/h5-6H,1-4H3;4-5H,10H2,1-3H3 |
| InChIKey | RPSCUWXATDJGSD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|