C10H14O5S — CID 89257255
methyl 4-hydroxy-2-methoxy-3,6-dimethylbenzenesulfonate (PubChem CID 89257255) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is methyl 4-hydroxy-2-methoxy-3,6-dimethylbenzenesulfonate.
| Compound Name | methyl 4-hydroxy-2-methoxy-3,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 89257255 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | methyl 4-hydroxy-2-methoxy-3,6-dimethylbenzenesulfonate |
| SMILES | COc1c(C)c(O)cc(C)c1S(=O)(=O)OC |
| InChI | InChI=1S/C10H14O5S/c1-6-5-8(11)7(2)9(14-3)10(6)16(12,13)15-4/h5,11H,1-4H3 |
| InChIKey | LODRNRCRJVTROF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|