C19H25NO5S2 — CID 169432194
N-methoxy-2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)sulfonylbenzenesulfonamide (PubChem CID 169432194) has the molecular formula C19H25NO5S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-methoxy-2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)sulfonylbenzenesulfonamide.
| Compound Name | N-methoxy-2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 169432194 |
| Molecular Formula | C19H25NO5S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-methoxy-2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)sulfonylbenzenesulfonamide |
| SMILES | CON(S(=O)(=O)c1c(C)cc(C)cc1C)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H25NO5S2/c1-12-8-14(3)18(15(4)9-12)26(21,22)20(25-7)27(23,24)19-16(5)10-13(2)11-17(19)6/h8-11H,1-7H3 |
| InChIKey | XDIJDDPDKSCIKG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|