C12H16NO4S- — CID 7439655
2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate (PubChem CID 7439655) has the molecular formula C12H16NO4S- and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate.
| Compound Name | 2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7439655 |
| Molecular Formula | C12H16NO4S- |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C)CC(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C12H17NO4S/c1-8-5-9(2)12(10(3)6-8)18(16,17)13(4)7-11(14)15/h5-6H,7H2,1-4H3,(H,14,15)/p-1 |
| InChIKey | JEGBBPOMNSEZSD-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |