C19H22NO4S- — CID 2202483
2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate (PubChem CID 2202483) has the molecular formula C19H22NO4S- and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate.
| Compound Name | 2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 2202483 |
| Molecular Formula | C19H22NO4S- |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]acetate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CCc2ccccc2)CC(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C19H23NO4S/c1-14-11-15(2)19(16(3)12-14)25(23,24)20(13-18(21)22)10-9-17-7-5-4-6-8-17/h4-8,11-12H,9-10,13H2,1-3H3,(H,21,22)/p-1 |
| InChIKey | SGCZXEPEPXHJPJ-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |