C29H32Cl3N3O3S — CID 166345157
2,4,6-trimethyl-N-[2-oxo-2-[4-(3,4,5-trichlorophenyl)piperazin-1-yl]ethyl]-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 166345157) has the molecular formula C29H32Cl3N3O3S and a molecular weight of 609.02 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[2-oxo-2-[4-(3,4,5-trichlorophenyl)piperazin-1-yl]ethyl]-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[2-oxo-2-[4-(3,4,5-trichlorophenyl)piperazin-1-yl]ethyl]-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166345157 |
| Molecular Formula | C29H32Cl3N3O3S |
| Molecular Weight | 609.02 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | 2,4,6-trimethyl-N-[2-oxo-2-[4-(3,4,5-trichlorophenyl)piperazin-1-yl]ethyl]-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CCc2ccccc2)CC(=O)N2CCN(c3cc(Cl)c(Cl)c(Cl)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C29H32Cl3N3O3S/c1-20-15-21(2)29(22(3)16-20)39(37,38)35(10-9-23-7-5-4-6-8-23)19-27(36)34-13-11-33(12-14-34)24-17-25(30)28(32)26(31)18-24/h4-8,15-18H,9-14,19H2,1-3H3 |
| InChIKey | DPJYPSYSEZVFOR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.02 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|