C11H14NO5S- — CID 7473070
2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]acetate (PubChem CID 7473070) has the molecular formula C11H14NO5S- and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]acetate.
| Compound Name | 2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 7473070 |
| Molecular Formula | C11H14NO5S- |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[(2-methoxy-5-methylphenyl)sulfonyl-methylamino]acetate |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(C)CC(=O)[O-] |
| InChI | InChI=1S/C11H15NO5S/c1-8-4-5-9(17-3)10(6-8)18(15,16)12(2)7-11(13)14/h4-6H,7H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | MWAUMGVPKFBQTA-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |