C12H16NO5S- — CID 2234317
2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetate (PubChem CID 2234317) has the molecular formula C12H16NO5S- and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetate.
| Compound Name | 2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 2234317 |
| Molecular Formula | C12H16NO5S- |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[ethyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetate |
| SMILES | CCN(CC(=O)[O-])S(=O)(=O)c1cc(C)ccc1OC |
| InChI | InChI=1S/C12H17NO5S/c1-4-13(8-12(14)15)19(16,17)11-7-9(2)5-6-10(11)18-3/h5-7H,4,8H2,1-3H3,(H,14,15)/p-1 |
| InChIKey | HSDRPLFCNVJYLC-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |