C16H27NO3S — CID 166187507
2-methoxy-5-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide (PubChem CID 166187507) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 2-methoxy-5-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide.
| Compound Name | 2-methoxy-5-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166187507 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-methoxy-5-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C16H27NO3S/c1-12(2)10-17(11-13(3)4)21(18,19)16-9-14(5)7-8-15(16)20-6/h7-9,12-13H,10-11H2,1-6H3 |
| InChIKey | LRKNTRQFXSENCG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |