C15H26N2O3S — CID 43587371
5-amino-2-methoxy-N,N-bis(2-methylpropyl)benzenesulfonamide (PubChem CID 43587371) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 5-amino-2-methoxy-N,N-bis(2-methylpropyl)benzenesulfonamide.
| Compound Name | 5-amino-2-methoxy-N,N-bis(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43587371 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-amino-2-methoxy-N,N-bis(2-methylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C15H26N2O3S/c1-11(2)9-17(10-12(3)4)21(18,19)15-8-13(16)6-7-14(15)20-5/h6-8,11-12H,9-10,16H2,1-5H3 |
| InChIKey | AAKYSQQPCIPNQI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|