C13H19N3O3S — CID 43577677
5-amino-N-(2-cyanoethyl)-2-methoxy-N-propan-2-ylbenzenesulfonamide (PubChem CID 43577677) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-amino-N-(2-cyanoethyl)-2-methoxy-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2-cyanoethyl)-2-methoxy-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 43577677 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-amino-N-(2-cyanoethyl)-2-methoxy-N-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)N(CCC#N)C(C)C |
| InChI | InChI=1S/C13H19N3O3S/c1-10(2)16(8-4-7-14)20(17,18)13-9-11(15)5-6-12(13)19-3/h5-6,9-10H,4,8,15H2,1-3H3 |
| InChIKey | RWSRWISPMXBBJE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|