C14H20N2O4S — CID 3711528
N-(2-cyanoethyl)-2,5-dimethoxy-N-propylbenzenesulfonamide (PubChem CID 3711528) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2,5-dimethoxy-N-propylbenzenesulfonamide.
| Compound Name | N-(2-cyanoethyl)-2,5-dimethoxy-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 3711528 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(2-cyanoethyl)-2,5-dimethoxy-N-propylbenzenesulfonamide |
| SMILES | CCCN(CCC#N)S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H20N2O4S/c1-4-9-16(10-5-8-15)21(17,18)14-11-12(19-2)6-7-13(14)20-3/h6-7,11H,4-5,9-10H2,1-3H3 |
| InChIKey | PVUHELTUAWALLD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |