C16H27NO4S — CID 19682241
N,N-dibutyl-2,4-dimethoxybenzenesulfonamide (PubChem CID 19682241) has the molecular formula C16H27NO4S and a molecular weight of 329.46 g/mol. Its IUPAC name is N,N-dibutyl-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N,N-dibutyl-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 19682241 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N,N-dibutyl-2,4-dimethoxybenzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C16H27NO4S/c1-5-7-11-17(12-8-6-2)22(18,19)16-10-9-14(20-3)13-15(16)21-4/h9-10,13H,5-8,11-12H2,1-4H3 |
| InChIKey | OALHGIWSZNSZLV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |