C11H16ClNO5S — CID 61233833
4-chloro-N,N-bis(2-hydroxyethyl)-2-methoxybenzenesulfonamide (PubChem CID 61233833) has the molecular formula C11H16ClNO5S and a molecular weight of 309.77 g/mol. Its IUPAC name is 4-chloro-N,N-bis(2-hydroxyethyl)-2-methoxybenzenesulfonamide.
| Compound Name | 4-chloro-N,N-bis(2-hydroxyethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 61233833 |
| Molecular Formula | C11H16ClNO5S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-chloro-N,N-bis(2-hydroxyethyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Cl)ccc1S(=O)(=O)N(CCO)CCO |
| InChI | InChI=1S/C11H16ClNO5S/c1-18-10-8-9(12)2-3-11(10)19(16,17)13(4-6-14)5-7-15/h2-3,8,14-15H,4-7H2,1H3 |
| InChIKey | XFMRGJGFWDMKKW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |