C10H14ClNO4S — CID 43501480
4-chloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide (PubChem CID 43501480) has the molecular formula C10H14ClNO4S and a molecular weight of 279.75 g/mol. Its IUPAC name is 4-chloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide.
| Compound Name | 4-chloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43501480 |
| Molecular Formula | C10H14ClNO4S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 4-chloro-N-(3-hydroxypropyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Cl)ccc1S(=O)(=O)NCCCO |
| InChI | InChI=1S/C10H14ClNO4S/c1-16-9-7-8(11)3-4-10(9)17(14,15)12-5-2-6-13/h3-4,7,12-13H,2,5-6H2,1H3 |
| InChIKey | CESUHVSFRDTYIM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|