C13H18ClNO5S — CID 60716385
ethyl 4-[(4-chloro-2-methoxyphenyl)sulfonylamino]butanoate (PubChem CID 60716385) has the molecular formula C13H18ClNO5S and a molecular weight of 335.81 g/mol. Its IUPAC name is ethyl 4-[(4-chloro-2-methoxyphenyl)sulfonylamino]butanoate.
| Compound Name | ethyl 4-[(4-chloro-2-methoxyphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 60716385 |
| Molecular Formula | C13H18ClNO5S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | ethyl 4-[(4-chloro-2-methoxyphenyl)sulfonylamino]butanoate |
| SMILES | CCOC(=O)CCCNS(=O)(=O)c1ccc(Cl)cc1OC |
| InChI | InChI=1S/C13H18ClNO5S/c1-3-20-13(16)5-4-8-15-21(17,18)12-7-6-10(14)9-11(12)19-2/h6-7,9,15H,3-5,8H2,1-2H3 |
| InChIKey | PNGLIZGKHZMVIF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|