C11H16ClNO4S — CID 115477790
4-chloro-N-(4-hydroxybutan-2-yl)-2-methoxybenzenesulfonamide (PubChem CID 115477790) has the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. Its IUPAC name is 4-chloro-N-(4-hydroxybutan-2-yl)-2-methoxybenzenesulfonamide.
| Compound Name | 4-chloro-N-(4-hydroxybutan-2-yl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 115477790 |
| Molecular Formula | C11H16ClNO4S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-chloro-N-(4-hydroxybutan-2-yl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Cl)ccc1S(=O)(=O)NC(C)CCO |
| InChI | InChI=1S/C11H16ClNO4S/c1-8(5-6-14)13-18(15,16)11-4-3-9(12)7-10(11)17-2/h3-4,7-8,13-14H,5-6H2,1-2H3 |
| InChIKey | XLUUSTYLTMXGOQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |