C14H23NO5S — CID 103918378
N-(6-hydroxyhexyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 103918378) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(6-hydroxyhexyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 103918378 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-(6-hydroxyhexyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCCCCO)c(OC)c1 |
| InChI | InChI=1S/C14H23NO5S/c1-19-12-7-8-14(13(11-12)20-2)21(17,18)15-9-5-3-4-6-10-16/h7-8,11,15-16H,3-6,9-10H2,1-2H3 |
| InChIKey | AUGOGPXZDZKGTR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|