C15H25NO4S — CID 19681274
N-heptyl-2,5-dimethoxybenzenesulfonamide (PubChem CID 19681274) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-heptyl-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-heptyl-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 19681274 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-heptyl-2,5-dimethoxybenzenesulfonamide |
| SMILES | CCCCCCCNS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H25NO4S/c1-4-5-6-7-8-11-16-21(17,18)15-12-13(19-2)9-10-14(15)20-3/h9-10,12,16H,4-8,11H2,1-3H3 |
| InChIKey | BVHAZUIKRDHIPA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|