C17H20ClNO4S — CID 141008380
N-[3-(3-chlorophenyl)propyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 141008380) has the molecular formula C17H20ClNO4S and a molecular weight of 369.87 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)propyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[3-(3-chlorophenyl)propyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 141008380 |
| Molecular Formula | C17H20ClNO4S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[3-(3-chlorophenyl)propyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H20ClNO4S/c1-22-15-8-9-16(23-2)17(12-15)24(20,21)19-10-4-6-13-5-3-7-14(18)11-13/h3,5,7-9,11-12,19H,4,6,10H2,1-2H3 |
| InChIKey | ZWYRUIVFGMFXTP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|