C17H20ClNO4S — CID 113100078
5-chloro-N-[2-(3-ethylphenoxy)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 113100078) has the molecular formula C17H20ClNO4S and a molecular weight of 369.87 g/mol. Its IUPAC name is 5-chloro-N-[2-(3-ethylphenoxy)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-[2-(3-ethylphenoxy)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113100078 |
| Molecular Formula | C17H20ClNO4S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-chloro-N-[2-(3-ethylphenoxy)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | CCc1cccc(OCCNS(=O)(=O)c2cc(Cl)ccc2OC)c1 |
| InChI | InChI=1S/C17H20ClNO4S/c1-3-13-5-4-6-15(11-13)23-10-9-19-24(20,21)17-12-14(18)7-8-16(17)22-2/h4-8,11-12,19H,3,9-10H2,1-2H3 |
| InChIKey | YLDKZHZKXVNANI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|