C19H25NO3S — CID 113100044
N-[2-(3-ethylphenoxy)ethyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 113100044) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[2-(3-ethylphenoxy)ethyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[2-(3-ethylphenoxy)ethyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113100044 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[2-(3-ethylphenoxy)ethyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CCc1cccc(OCCNS(=O)(=O)c2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C19H25NO3S/c1-5-17-7-6-8-18(13-17)23-10-9-20-24(21,22)19-15(3)11-14(2)12-16(19)4/h6-8,11-13,20H,5,9-10H2,1-4H3 |
| InChIKey | MARFCKHMIDKLLI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|