C14H19N3O3S — CID 60700211
3,5-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 60700211) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60700211 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3,5-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1cccc(OCCNS(=O)(=O)c2c(C)n[nH]c2C)c1 |
| InChI | InChI=1S/C14H19N3O3S/c1-10-5-4-6-13(9-10)20-8-7-15-21(18,19)14-11(2)16-17-12(14)3/h4-6,9,15H,7-8H2,1-3H3,(H,16,17) |
| InChIKey | JZUAEPHIVBRYKB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|