C19H24ClN5O3S — CID 142640380
3,5-dimethyl-N-[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]-1H-pyrazole-4-sulfonamide;hydrochloride (PubChem CID 142640380) has the molecular formula C19H24ClN5O3S and a molecular weight of 437.95 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]-1H-pyrazole-4-sulfonamide;hydrochloride.
| Compound Name | 3,5-dimethyl-N-[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]-1H-pyrazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 142640380 |
| Molecular Formula | C19H24ClN5O3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3,5-dimethyl-N-[3-methyl-5-[2-(pyridin-4-ylamino)ethoxy]phenyl]-1H-pyrazole-4-sulfonamide;hydrochloride |
| SMILES | Cc1cc(NS(=O)(=O)c2c(C)n[nH]c2C)cc(OCCNc2ccncc2)c1.Cl |
| InChI | InChI=1S/C19H23N5O3S.ClH/c1-13-10-17(24-28(25,26)19-14(2)22-23-15(19)3)12-18(11-13)27-9-8-21-16-4-6-20-7-5-16;/h4-7,10-12,24H,8-9H2,1-3H3,(H,20,21)(H,22,23);1H |
| InChIKey | SOKBUPXMKZOOGA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|