C13H17N3O2S — CID 866897
N-(3,5-dimethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 866897) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 866897 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2c(C)n[nH]c2C)c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8-5-9(2)7-12(6-8)16-19(17,18)13-10(3)14-15-11(13)4/h5-7,16H,1-4H3,(H,14,15) |
| InChIKey | YWWIMIIDROAJQG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |