C11H11Cl2N3O2S — CID 26952341
N-(3,4-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 26952341) has the molecular formula C11H11Cl2N3O2S and a molecular weight of 320.20 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 26952341 |
| Molecular Formula | C11H11Cl2N3O2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N3O2S/c1-6-11(7(2)15-14-6)19(17,18)16-8-3-4-9(12)10(13)5-8/h3-5,16H,1-2H3,(H,14,15) |
| InChIKey | YCGDWBBAPAWPQZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |