C14H11Cl2N3O2S — CID 22567293
N-(3,4-dichlorophenyl)-3-methyl-2H-indazole-5-sulfonamide (PubChem CID 22567293) has the molecular formula C14H11Cl2N3O2S and a molecular weight of 356.23 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-methyl-2H-indazole-5-sulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-methyl-2H-indazole-5-sulfonamide |
|---|---|
| PubChem CID | 22567293 |
| Molecular Formula | C14H11Cl2N3O2S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-methyl-2H-indazole-5-sulfonamide |
| SMILES | Cc1[nH]nc2ccc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)cc12 |
| InChI | InChI=1S/C14H11Cl2N3O2S/c1-8-11-7-10(3-5-14(11)18-17-8)22(20,21)19-9-2-4-12(15)13(16)6-9/h2-7,19H,1H3,(H,17,18) |
| InChIKey | KFCJWDCLXKTDKE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |