C20H14Cl2N4O3S — CID 22567162
N-[5-[(3,4-dichlorophenyl)sulfamoyl]-1H-indazol-3-yl]benzamide (PubChem CID 22567162) has the molecular formula C20H14Cl2N4O3S and a molecular weight of 461.33 g/mol. Its IUPAC name is N-[5-[(3,4-dichlorophenyl)sulfamoyl]-1H-indazol-3-yl]benzamide.
| Compound Name | N-[5-[(3,4-dichlorophenyl)sulfamoyl]-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 22567162 |
| Molecular Formula | C20H14Cl2N4O3S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | N-[5-[(3,4-dichlorophenyl)sulfamoyl]-1H-indazol-3-yl]benzamide |
| SMILES | O=C(Nc1n[nH]c2ccc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H14Cl2N4O3S/c21-16-8-6-13(10-17(16)22)26-30(28,29)14-7-9-18-15(11-14)19(25-24-18)23-20(27)12-4-2-1-3-5-12/h1-11,26H,(H2,23,24,25,27) |
| InChIKey | XBWHMYWCWPRDEL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |