C21H16N4O3 — CID 142752240
3-benzamido-N-(3-hydroxyphenyl)-1H-indazole-5-carboxamide (PubChem CID 142752240) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 3-benzamido-N-(3-hydroxyphenyl)-1H-indazole-5-carboxamide.
| Compound Name | 3-benzamido-N-(3-hydroxyphenyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 142752240 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-benzamido-N-(3-hydroxyphenyl)-1H-indazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc2[nH]nc(NC(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H16N4O3/c26-16-8-4-7-15(12-16)22-21(28)14-9-10-18-17(11-14)19(25-24-18)23-20(27)13-5-2-1-3-6-13/h1-12,26H,(H,22,28)(H2,23,24,25,27) |
| InChIKey | PRUFGXHTQBGXCP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |