C20H13Cl2N3O4S — CID 22567407
(3,4-dichlorophenyl) 3-benzamido-1H-indazole-5-sulfonate (PubChem CID 22567407) has the molecular formula C20H13Cl2N3O4S and a molecular weight of 462.31 g/mol. Its IUPAC name is (3,4-dichlorophenyl) 3-benzamido-1H-indazole-5-sulfonate.
| Compound Name | (3,4-dichlorophenyl) 3-benzamido-1H-indazole-5-sulfonate |
|---|---|
| PubChem CID | 22567407 |
| Molecular Formula | C20H13Cl2N3O4S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | (3,4-dichlorophenyl) 3-benzamido-1H-indazole-5-sulfonate |
| SMILES | O=C(Nc1n[nH]c2ccc(S(=O)(=O)Oc3ccc(Cl)c(Cl)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H13Cl2N3O4S/c21-16-8-6-13(10-17(16)22)29-30(27,28)14-7-9-18-15(11-14)19(25-24-18)23-20(26)12-4-2-1-3-5-12/h1-11H,(H2,23,24,25,26) |
| InChIKey | WXRVHQACFMNLFZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|