C13H7Cl3N2O3S — CID 22567348
(3,4-dichlorophenyl) 3-chloro-2H-indazole-5-sulfonate (PubChem CID 22567348) has the molecular formula C13H7Cl3N2O3S and a molecular weight of 377.64 g/mol. Its IUPAC name is (3,4-dichlorophenyl) 3-chloro-2H-indazole-5-sulfonate.
| Compound Name | (3,4-dichlorophenyl) 3-chloro-2H-indazole-5-sulfonate |
|---|---|
| PubChem CID | 22567348 |
| Molecular Formula | C13H7Cl3N2O3S |
| Molecular Weight | 377.64 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | (3,4-dichlorophenyl) 3-chloro-2H-indazole-5-sulfonate |
| SMILES | O=S(=O)(Oc1ccc(Cl)c(Cl)c1)c1ccc2n[nH]c(Cl)c2c1 |
| InChI | InChI=1S/C13H7Cl3N2O3S/c14-10-3-1-7(5-11(10)15)21-22(19,20)8-2-4-12-9(6-8)13(16)18-17-12/h1-6H,(H,17,18) |
| InChIKey | RBTYQJXSZSJHJE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|