C13H9Cl2NO5S — CID 35293704
(3,4-dichlorophenyl) 2-methyl-3-nitrobenzenesulfonate (PubChem CID 35293704) has the molecular formula C13H9Cl2NO5S and a molecular weight of 362.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl) 2-methyl-3-nitrobenzenesulfonate.
| Compound Name | (3,4-dichlorophenyl) 2-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 35293704 |
| Molecular Formula | C13H9Cl2NO5S |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | (3,4-dichlorophenyl) 2-methyl-3-nitrobenzenesulfonate |
| SMILES | Cc1c([N+](=O)[O-])cccc1S(=O)(=O)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl2NO5S/c1-8-12(16(17)18)3-2-4-13(8)22(19,20)21-9-5-6-10(14)11(15)7-9/h2-7H,1H3 |
| InChIKey | JXZRILWDVDMKDS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|