C12H8Cl2N2O5S — CID 15585522
(4-amino-3-nitrophenyl) 2,5-dichlorobenzenesulfonate (PubChem CID 15585522) has the molecular formula C12H8Cl2N2O5S and a molecular weight of 363.18 g/mol. Its IUPAC name is (4-amino-3-nitrophenyl) 2,5-dichlorobenzenesulfonate.
| Compound Name | (4-amino-3-nitrophenyl) 2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 15585522 |
| Molecular Formula | C12H8Cl2N2O5S |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | (4-amino-3-nitrophenyl) 2,5-dichlorobenzenesulfonate |
| SMILES | Nc1ccc(OS(=O)(=O)c2cc(Cl)ccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8Cl2N2O5S/c13-7-1-3-9(14)12(5-7)22(19,20)21-8-2-4-10(15)11(6-8)16(17)18/h1-6H,15H2 |
| InChIKey | ZJIACPOYVYTLAK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|