About (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate
(4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate (PubChem CID 21386672) has the molecular formula C12H9ClN2O5S
and a molecular weight of 328.73 g/mol. Its IUPAC name is (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate |
| PubChem CID | 21386672 |
| Molecular Formula | C12H9ClN2O5S |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate |
| SMILES | Nc1ccc(OS(=O)(=O)c2cccc(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9ClN2O5S/c13-8-2-1-3-10(6-8)21(18,19)20-9-4-5-11(14)12(7-9)15(16)17/h1-7H,14H2 |
| InChIKey | IUEMAZKNZCEOIB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate?
The IUPAC name of (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate (CID 21386672) is (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate.
What is the SMILES notation for (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate?
The canonical SMILES for (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate is Nc1ccc(OS(=O)(=O)c2cccc(Cl)c2)cc1[N+](=O)[O-].
What is the InChIKey of (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate?
The InChIKey is IUEMAZKNZCEOIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClN2O5S/c13-8-2-1-3-10(6-8)21(18,19)20-9-4-5-11(14)12(7-9)15(16)17/h1-7H,14H2.
What are the key properties of (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate?
(4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate has a molecular weight of 328.73 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-3-nitrophenyl) 3-chlorobenzenesulfonate is sourced from PubChem (CID 21386672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).