C13H13ClN2O3S — CID 21493537
(3,4-diaminophenyl) 5-chloro-2-methylbenzenesulfonate (PubChem CID 21493537) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is (3,4-diaminophenyl) 5-chloro-2-methylbenzenesulfonate.
| Compound Name | (3,4-diaminophenyl) 5-chloro-2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 21493537 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (3,4-diaminophenyl) 5-chloro-2-methylbenzenesulfonate |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)Oc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C13H13ClN2O3S/c1-8-2-3-9(14)6-13(8)20(17,18)19-10-4-5-11(15)12(16)7-10/h2-7H,15-16H2,1H3 |
| InChIKey | VLVTUHQZVPTAGC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|