C15H13F2NO4S — CID 39794864
(3,4-difluorophenyl) 5-acetamido-2-methylbenzenesulfonate (PubChem CID 39794864) has the molecular formula C15H13F2NO4S and a molecular weight of 341.34 g/mol. Its IUPAC name is (3,4-difluorophenyl) 5-acetamido-2-methylbenzenesulfonate.
| Compound Name | (3,4-difluorophenyl) 5-acetamido-2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 39794864 |
| Molecular Formula | C15H13F2NO4S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (3,4-difluorophenyl) 5-acetamido-2-methylbenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(C)c(S(=O)(=O)Oc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C15H13F2NO4S/c1-9-3-4-11(18-10(2)19)7-15(9)23(20,21)22-12-5-6-13(16)14(17)8-12/h3-8H,1-2H3,(H,18,19) |
| InChIKey | DPAOXGQSRBJUBU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|