C17H18F2N2O3S — CID 78797689
N-[3-[1-(3,4-difluorophenyl)ethylsulfamoyl]-4-methylphenyl]acetamide (PubChem CID 78797689) has the molecular formula C17H18F2N2O3S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[3-[1-(3,4-difluorophenyl)ethylsulfamoyl]-4-methylphenyl]acetamide.
| Compound Name | N-[3-[1-(3,4-difluorophenyl)ethylsulfamoyl]-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 78797689 |
| Molecular Formula | C17H18F2N2O3S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[3-[1-(3,4-difluorophenyl)ethylsulfamoyl]-4-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C)c(S(=O)(=O)NC(C)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H18F2N2O3S/c1-10-4-6-14(20-12(3)22)9-17(10)25(23,24)21-11(2)13-5-7-15(18)16(19)8-13/h4-9,11,21H,1-3H3,(H,20,22) |
| InChIKey | GFZPLLHBZITYTC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |