C22H22FN3O3S — CID 55905729
1-[4-[1-[(2-fluoro-5-methylphenyl)sulfonylamino]ethyl]phenyl]-3-phenylurea (PubChem CID 55905729) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-[4-[1-[(2-fluoro-5-methylphenyl)sulfonylamino]ethyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-[(2-fluoro-5-methylphenyl)sulfonylamino]ethyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 55905729 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[4-[1-[(2-fluoro-5-methylphenyl)sulfonylamino]ethyl]phenyl]-3-phenylurea |
| SMILES | Cc1ccc(F)c(S(=O)(=O)NC(C)c2ccc(NC(=O)Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H22FN3O3S/c1-15-8-13-20(23)21(14-15)30(28,29)26-16(2)17-9-11-19(12-10-17)25-22(27)24-18-6-4-3-5-7-18/h3-14,16,26H,1-2H3,(H2,24,25,27) |
| InChIKey | QYTXJCOXLYCSCH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |