C29H30N4O5S2 — CID 170548873
1,3-bis[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea (PubChem CID 170548873) has the molecular formula C29H30N4O5S2 and a molecular weight of 578.72 g/mol. Its IUPAC name is 1,3-bis[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea.
| Compound Name | 1,3-bis[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 170548873 |
| Molecular Formula | C29H30N4O5S2 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 1,3-bis[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(NC(=O)Nc3ccc(NS(=O)(=O)c4cc(C)ccc4C)cc3)cc2)c1 |
| InChI | InChI=1S/C29H30N4O5S2/c1-19-5-7-21(3)27(17-19)39(35,36)32-25-13-9-23(10-14-25)30-29(34)31-24-11-15-26(16-12-24)33-40(37,38)28-18-20(2)6-8-22(28)4/h5-18,32-33H,1-4H3,(H2,30,31,34) |
| InChIKey | XYVDLKLOWDANQH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |