C18H21N3O3S — CID 46534979
1-cyclopropyl-3-[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea (PubChem CID 46534979) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea.
| Compound Name | 1-cyclopropyl-3-[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 46534979 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-cyclopropyl-3-[4-[(2,5-dimethylphenyl)sulfonylamino]phenyl]urea |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(NC(=O)NC3CC3)cc2)c1 |
| InChI | InChI=1S/C18H21N3O3S/c1-12-3-4-13(2)17(11-12)25(23,24)21-16-9-7-15(8-10-16)20-18(22)19-14-5-6-14/h3-4,7-11,14,21H,5-6H2,1-2H3,(H2,19,20,22) |
| InChIKey | JIPYIANAEFHWHO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |