C20H26ClN3O3S — CID 119386321
4-[(2,5-dimethylphenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 119386321) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | 4-[(2,5-dimethylphenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119386321 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(C(=O)NC3CCNCC3)cc2)c1.Cl |
| InChI | InChI=1S/C20H25N3O3S.ClH/c1-14-3-4-15(2)19(13-14)27(25,26)23-18-7-5-16(6-8-18)20(24)22-17-9-11-21-12-10-17;/h3-8,13,17,21,23H,9-12H2,1-2H3,(H,22,24);1H |
| InChIKey | DZUJBTBQDBJHFF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |