C18H21ClFN3O3S — CID 119387628
4-[(4-fluorophenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 119387628) has the molecular formula C18H21ClFN3O3S and a molecular weight of 413.90 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119387628 |
| Molecular Formula | C18H21ClFN3O3S |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNCC1)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FN3O3S.ClH/c19-14-3-7-17(8-4-14)26(24,25)22-16-5-1-13(2-6-16)18(23)21-15-9-11-20-12-10-15;/h1-8,15,20,22H,9-12H2,(H,21,23);1H |
| InChIKey | XOBUSAUJUBJPKZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |