C13H17ClF2N2O3S — CID 119387742
4-(difluoromethylsulfonyl)-N-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 119387742) has the molecular formula C13H17ClF2N2O3S and a molecular weight of 354.81 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | 4-(difluoromethylsulfonyl)-N-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119387742 |
| Molecular Formula | C13H17ClF2N2O3S |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNCC1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C13H16F2N2O3S.ClH/c14-13(15)21(19,20)11-3-1-9(2-4-11)12(18)17-10-5-7-16-8-6-10;/h1-4,10,13,16H,5-8H2,(H,17,18);1H |
| InChIKey | LMXVKANOHPNCSS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |