C15H21ClF2N2O3S — CID 119556890
4-(difluoromethylsulfonyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride (PubChem CID 119556890) has the molecular formula C15H21ClF2N2O3S and a molecular weight of 382.86 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119556890 |
| Molecular Formula | C15H21ClF2N2O3S |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCCNC1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C15H20F2N2O3S.ClH/c16-15(17)23(21,22)13-5-3-12(4-6-13)14(20)19-9-7-11-2-1-8-18-10-11;/h3-6,11,15,18H,1-2,7-10H2,(H,19,20);1H |
| InChIKey | NYOWIAHHNFOSFO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |