C18H30ClN3O3S — CID 119555746
4-(tert-butylsulfamoyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride (PubChem CID 119555746) has the molecular formula C18H30ClN3O3S and a molecular weight of 403.98 g/mol. Its IUPAC name is 4-(tert-butylsulfamoyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride.
| Compound Name | 4-(tert-butylsulfamoyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119555746 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-(tert-butylsulfamoyl)-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NCCC2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C18H29N3O3S.ClH/c1-18(2,3)21-25(23,24)16-8-6-15(7-9-16)17(22)20-12-10-14-5-4-11-19-13-14;/h6-9,14,19,21H,4-5,10-13H2,1-3H3,(H,20,22);1H |
| InChIKey | HBWUWLHIFHQGLR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |