C16H24ClN3O4S — CID 119556684
4-(2-amino-2-oxoethyl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride (PubChem CID 119556684) has the molecular formula C16H24ClN3O4S and a molecular weight of 389.91 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethyl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride.
| Compound Name | 4-(2-amino-2-oxoethyl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119556684 |
| Molecular Formula | C16H24ClN3O4S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-(2-amino-2-oxoethyl)sulfonyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)CS(=O)(=O)c1ccc(C(=O)NCCC2CCCNC2)cc1 |
| InChI | InChI=1S/C16H23N3O4S.ClH/c17-15(20)11-24(22,23)14-5-3-13(4-6-14)16(21)19-9-7-12-2-1-8-18-10-12;/h3-6,12,18H,1-2,7-11H2,(H2,17,20)(H,19,21);1H |
| InChIKey | XBXDJLCIAAXHDL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |